(R)-2-(4-Hydroxyphenoxy)propanoic acid is a chiral organic compound featuring an aromatic ring, an ether linkage, and a carboxylic acid group. It is primarily utilized as a pharmaceutical intermediate in the synthesis of herbicides.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 94050-90-5
Ethyl 2-(4-hydroxyphenoxy)propionate
Pharmaceutical intermediate for herbicide synthesis
(2S,3aS,7aS)-Benzyl octahydro-1H-indole-2-carboxylate 4-methylbenzenesulfonate
Perindopril intermediate
Benzyl 2-carbamoylpiperidine-1-carboxylate
pharmaceutical intermediate
(E)-3-(6-(p-Toluoyl)-2-pyridyl)acrylic acid
pharmaceutical impurity reference standard
N-Benzylphenethylammonium diacetate
pharmaceutical intermediate
(2R)-2-(4-hydroxyphenoxy)propanoic acid
AQIHDXGKQHFBNW-ZCFIWIBFSA-N
C[C@H](C(=O)O)OC1=CC=C(C=C1)O