Dioctyl phthalate-3,4,5,6-d4 is a deuterium-labeled phthalate compound used primarily as a research reference standard. Its significance lies in its application as an internal standard for analytical methods studying phthalate plasticizers.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 93952-13-7
Dihexyl phthalate-3,4,5,6-d4
isotope labeled internal standard
Di-n-nonyl phthalate-3,4,5,6-d4
Deuterated analytical reference standard
Amyl Phthalate-d4
n.a
Di-n-butyl phthalate-d4
research compound
2-bromo-1-phenylnaphthalene
chemical intermediate for organic synthesis
2-Hydroxyethyl benzoate
industrial intermediate for specialty chemicals
BENZOYL PEROXIDE
Polymerization catalyst and bleaching agent
Dimethyl 1,4-cyclohexanedicarboxylate
plasticizer and polymer intermediate
dioctyl 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate
MQIUGAXCHLFZKX-AMEAAFLOSA-N
[2H]C1=C(C(=C(C(=C1[2H])C(=O)OCCCCCCCC)C(=O)OCCCCCCCC)[2H])[2H]