Dihexyl phthalate-3,4,5,6-d4 is a deuterated form of dihexyl phthalate where four hydrogen atoms on the aromatic ring are replaced with deuterium. It is primarily used as an isotope-labeled internal standard in analytical chemistry and research applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1015854-55-3
Di-n-nonyl phthalate-3,4,5,6-d4
Deuterated analytical reference standard
Dioctyl phthalate-3,4,5,6-d4
Phthalate plasticizer research reference standard
Amyl Phthalate-d4
n.a
Di-n-butyl phthalate-d4
research compound
4,4,5-trideuterio-5-[dideuterio(morpholin-4-yl)methyl]-3-[(E)-(5-nitrofuran-2-yl)methylideneamino]-1,3-oxazolidin-2-one
deuterated internal standard for veterinary drug residue analysis
7-Bromo-1-heptanol
research compound
3,3-Diethoxypropyne
Synthetic building block for organic synthesis
2-AMINO-5-METHOXYPYRIDINE
Research reagent
dihexyl 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate
KCXZNSGUUQJJTR-LSQQNFJSSA-N
[2H]C1=C(C(=C(C(=C1[2H])C(=O)OCCCCCC)C(=O)OCCCCCC)[2H])[2H]