This compound is a deuterated analogue of 1,2-dichloropropane, specifically labeled with six deuterium atoms. It is primarily used as an internal standard or tracer in analytical research, including mass spectrometry and nuclear magnetic resonance spectroscopy, to enable precise quantification and structural elucidation.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 93952-08-0
Di-n-butyl phthalate-d4
research compound
1,2-Benzene-3,4,5,6-d4-dicarboxylic acid, diethyl ester
deuterated analytical reference standard
P,p'-DDT-d8
reference standard for analytical chemistry
P,p'-DDD-d8
isotopically labeled research compound
1,2-DICHLOROPROPANE
Chemical intermediate for chlorinated chemicals
1,2-dichloro-1,1,2,3,3,3-hexadeuteriopropane
KNKRKFALVUDBJE-LIDOUZCJSA-N
[2H]C([2H])([2H])C([2H])(C([2H])([2H])Cl)Cl