p,p'-DDT-d8 is a deuterium-labeled analog of the organochlorine compound DDT, specifically used as a reference standard in analytical chemistry. Its primary significance lies in providing a stable isotope-labeled internal standard for the quantification of DDT residues in environmental and biological samples.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 93952-18-2
Phenethyl Alcohol-d5
reference standard for analytical chemistry
Phenol-2,3,4,5,6-d5
reference standard for analytical chemistry
P,p'-DDD-d8
isotopically labeled research compound
3,3',4,4'-TETRACHLOROBIPHENYL-D6
isotopically labeled research compound
Pyrazine-2,6-dicarboxylic Acid
research compound
P-Toluenesulfonyl azide
Synthetic reagent for diazo transfer
1-Chloro-4-[2,2,2-trichloro-1-(4-chlorophenyl)ethyl]benzene
insecticide and pesticide
1-chloro-2,3,5,6-tetradeuterio-4-[2,2,2-trichloro-1-(4-chloro-2,3,5,6-tetradeuteriophenyl)ethyl]benzene
YVGGHNCTFXOJCH-PGRXLJNUSA-N
[2H]C1=C(C(=C(C(=C1C(C2=C(C(=C(C(=C2[2H])[2H])Cl)[2H])[2H])C(Cl)(Cl)Cl)[2H])[2H])Cl)[2H]