Bis-2-ethylhexyl phthalate d4 is a deuterium-labeled derivative of the industrial chemical bis(2-ethylhexyl) phthalate, used primarily as a phthalate plasticizer. Its structure features a fully deuterated aromatic ring with two ester groups, contributing to its high flexibility and non-polar character.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 93951-87-2
Dioctyl phthalate-3,4,5,6-d4
Phthalate plasticizer research reference standard
2-bromo-1-phenylnaphthalene
chemical intermediate for organic synthesis
2-Hydroxyethyl benzoate
industrial intermediate for specialty chemicals
BENZOYL PEROXIDE
Polymerization catalyst and bleaching agent
Bis(2-ethylhexyl) phthalate
plasticizer for polymer materials
bis(2-ethylhexyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate
BJQHLKABXJIVAM-SAQXESPHSA-N
[2H]C1=C(C(=C(C(=C1[2H])C(=O)OCC(CC)CCCC)C(=O)OCC(CC)CCCC)[2H])[2H]