rac N-Benzyl Nebivolol is a pharmaceutical intermediate used in the synthesis of nebivolol-related compounds. It features a complex structure with multiple aromatic rings, ether linkages, and alcohol functional groups, indicating its role in specialized chemical manufacturing.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 929706-85-4
Maxacalcitol Impurity 8
Pharmaceutical impurity reference standard
3-bromo-4-methyl-5-nitropyridin-2-amine
Pharmaceutical intermediate for synthesis
2,5-Dimethoxybenzaldehyde
Pharmaceutical intermediate for phenethylamine synthesis
3,4-Dimethoxybenzoic acid
pharmaceutical intermediate
2-[benzyl-[2-(6-fluoro-3,4-dihydro-2H-chromen-2-yl)-2-hydroxyethyl]amino]-1-(6-fluoro-3,4-dihydro-2H-chromen-2-yl)ethanol
STEPXTPIBUXRLE-UHFFFAOYSA-N
C1CC2=C(C=CC(=C2)F)OC1C(CN(CC3=CC=CC=C3)CC(C4CCC5=C(O4)C=CC(=C5)F)O)O