3,4-Dimethoxybenzoic acid is a chemical compound used as an intermediate in pharmaceutical manufacturing. It features a benzoic acid core substituted with two methoxy groups, contributing to its role in the synthesis of various active pharmaceutical ingredients.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 93-07-2
Homoveratric acid
Pharmaceutical intermediate research compound
(r)-4-propylpyrrolidin-2-one
pharmaceutical intermediate
3-(2-chloroethyl)-2-methyl-4H,6H,7H,8H,9H-pyrido[1,2-a]pyrimidin-4-one hydrochloride
pharmaceutical intermediate
1-Benzyl 4-tert-butyl (2R)-2-(hydroxymethyl)piperazine-1,4-dicarboxylate
pharmaceutical intermediate
3,4-dimethoxybenzoic acid
DAUAQNGYDSHRET-UHFFFAOYSA-N
COC1=C(C=C(C=C1)C(=O)O)OC