2,4-Dimethoxybenzoic acid is a research compound with a structure featuring an aromatic ring substituted by two methoxy groups and a carboxylic acid group. Its crystalline structure has been characterized in crystallographic studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 91-52-1
2',4'-Dimethoxyacetophenone
Research compound and chemical intermediate
3,3'-Diaminobenzidine
Peroxidase histochemical reagent
3-[N-Tris-(hydroxymethyl)methylamino]propanesulphonic acid, sodium salt
biological buffer research reagent
N-(2-Picolinoylphenyl)benzamide
research compound
Potassium (tert-butoxymethyl)trifluoroborate
organoboron reagent for cross-coupling
2,4-dimethoxybenzoic acid
GPVDHNVGGIAOQT-UHFFFAOYSA-N
COC1=CC(=C(C=C1)C(=O)O)OC