This compound is a sodium sulfonate salt used primarily as a biological buffer in research. It is a highly polar, water-soluble molecule containing multiple hydroxyl groups and an amine group, which contribute to its buffering capacity in laboratory settings.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 91000-53-2
TES sodium salt
biological buffer reagent
N-(2-Picolinoylphenyl)benzamide
research compound
Potassium (tert-butoxymethyl)trifluoroborate
organoboron reagent for cross-coupling
Potassium trifluoro(methoxymethyl)borate(1-)
borate salt research reagent
Gdrgdsp
integrin binding assay research reagent
3-(Tris(hydroxymethyl)methylamino)-1-propanesulfonic acid
Biological buffer
sodium 3-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]propane-1-sulfonate
FEGYIWVHCSRXCG-UHFFFAOYSA-M
C(CNC(CO)(CO)CO)CS(=O)(=O)[O-].[Na+]