Pectin is a naturally occurring polysaccharide found in plant cell walls, commonly used as a gelling agent and thickener in food products. It is particularly valued for its ability to form gels in the presence of sugar and acid, making it essential for jams and jellies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 9000-69-5
Beta-D-glucose
nutrient replenisher and sweetener
Lysozyme (chicken egg white)
enzyme used in cheese production
Agar
Food thickener and gelling agent
Carboxymethylcellulose sodium salt
Food additive and thickener
D-Glucopyranuronic acid
Biochemical research reagent
(2S,3R,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylic acid
AEMOLEFTQBMNLQ-DTEWXJGMSA-N
[C@@H]1([C@H]([C@H](O[C@H]([C@@H]1O)O)C(=O)O)O)O