L-Leucine-5,5,5-d3 is a deuterated amino acid used as a research reagent. It is a labeled form of L-leucine where three hydrogen atoms at the 5-position are replaced with deuterium, enabling tracing in metabolic studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 87828-86-2
Piperidine-4-sulfonic acid amide
research compound
1-cyclopropyl-4-isothiocyanatonaphthalene
research compound
Methyl 2-((5-amino-4-(4-cyclopropylnaphthalen-1-yl)-4H-1,2,4-triazol-3-yl)thio)acetate
Research compound
Fmoc-Tyr(tBu)-Ser(Psi(Me,Me)pro)-OH
Research reagent for peptide synthesis
L-LEUCINE-D7
isotopically labeled amino acid
Deuterated L-leucine
deuterated compound for research
2-amino-2,3,3,4,5,5,5-heptadeuterio-4-(trideuteriomethyl)pentanoic acid
deuterated research compound
D-LEUCINE
metabolite research compound
(2S)-2-amino-5,5,5-trideuterio-4-methylpentanoic acid
ROHFNLRQFUQHCH-LONBSJBQSA-N
[2H]C([2H])([2H])C(C)C[C@@H](C(=O)O)N