Leucine-d10 is a deuterated compound used primarily as a research reagent. Its structure features ten deuterium atoms replacing hydrogen, making it valuable for tracing and analytical studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 29909-01-1
2,5-Difluorobenzoic acid
research compound
3-(Tris(hydroxymethyl)methylamino)-1-propanesulfonic acid
Biological buffer
Isopropyl bromoacetate
research reagent
4-Aminophenylsulphur pentafluoride
Research chemical for synthesis
D-LEUCINE
metabolite research compound
DL-Leucine
Pharmaceutical intermediate for peptide synthesis
ليوسين
nutritional supplement and flavoring agent
L-Leucine-5,5,5-d3
Deuterated amino acid research reagent
2-amino-2,3,3,4,5,5,5-heptadeuterio-4-(trideuteriomethyl)pentanoic acid
ROHFNLRQFUQHCH-SHJFKSRGSA-N
[2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])C([2H])([2H])C([2H])(C(=O)O)N