Phenyl 2-hydroxy-4,5-dimethoxybenzoate is a research compound. It is a synthetic ester containing aromatic rings and ether groups, used primarily in laboratory and research settings.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 877997-98-3
2-Pyridinamine-d4
Deuterated research standard for analytical chemistry
L-Leucine-5,5,5-d3
Deuterated amino acid research reagent
Piperidine-4-sulfonic acid amide
research compound
1-cyclopropyl-4-isothiocyanatonaphthalene
research compound
Phenyl salicylate
UV filter and polymer additive
4-((((2S)-Octan-2-yl)oxy)carbonyl)phenyl 4-(hexyloxy)benzoate
liquid crystal intermediate
phenyl 2-hydroxy-4,5-dimethoxybenzoate
JXURAFZSOJQXKD-UHFFFAOYSA-N
COC1=C(C=C(C(=C1)C(=O)OC2=CC=CC=C2)O)OC
—