إندول حمض الأسيتيك
Indole-3-acetic acid is the most common naturally occurring plant hormone of the auxin class. It plays a central role in regulating plant growth, including cell elongation, division, and differentiation.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 87-51-4
Mucochloric acid
herbicide and acaricide intermediate
2,6-Dimethylaniline
intermediate in manufacturing pesticides
2-Chloro-6-methylaniline
Avicide for bird pest control
Pentachlorophenol
wood preservative biocide
Indole-2,4,5,6,7-d5-3-acetic acid
Deuterated biochemical research reagent
2-(1H-indol-3-yl)acetic acid
SEOVTRFCIGRIMH-UHFFFAOYSA-N
C1=CC=C2C(=C1)C(=CN2)CC(=O)O