This compound is a deuterated derivative of indole-3-acetic acid, a naturally occurring auxin plant hormone. It is used as a stable isotope-labeled research reagent for biochemical and metabolic studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 76937-78-5
8-Bromo-cAMP sodium salt
research compound
2-Fluoro-4-methylbenzoic acid
research chemical intermediate
2-chloro-4-methylbenzoic acid
research compound
3-Bromo-4-methylbenzoic acid
synthetic intermediate for organic chemistry
إندول حمض الأسيتيك
plant growth hormone auxin
2-(2,4,5,6,7-pentadeuterio-1H-indol-3-yl)acetic acid
SEOVTRFCIGRIMH-SNOLXCFTSA-N
[2H]C1=C(C(=C2C(=C1[2H])C(=C(N2)[2H])CC(=O)O)[2H])[2H]