Fluazuron is an agrochemical compound used primarily as an acaricide and mite growth regulator. It is characterized by a complex molecular structure containing multiple halogen atoms and aromatic rings, which contributes to its activity against target pests.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 86811-58-7
إندول حمض الأسيتيك
plant growth hormone auxin
Mucochloric acid
herbicide and acaricide intermediate
2,6-Dimethylaniline
intermediate in manufacturing pesticides
2-Chloro-6-methylaniline
Avicide for bird pest control
N-[[4-chloro-3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]carbamoyl]-2,6-difluorobenzamide
YOWNVPAUWYHLQX-UHFFFAOYSA-N
C1=CC(=C(C(=C1)F)C(=O)NC(=O)NC2=CC(=C(C=C2)Cl)OC3=C(C=C(C=N3)C(F)(F)F)Cl)F