m-Tolidine is an organic compound used as an intermediate in the synthesis of dyes and pigments. It consists of two aromatic rings connected by a single bond, each bearing an amino group and a methyl substituent, contributing to its reactivity and utility in industrial chemical processes.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 84-67-3
2-amino-4-methyl-6-nitrophenol
intermediate for dye and pigment synthesis
Naphthionic acid
Naphthalene sulfonic acid dye intermediate
1-NAPHTHOL-4-SULFONIC ACID
dye intermediate
5-aminonaphthalene-1-sulfonic acid
dye intermediate
5,6-diaminonaphthalene-1-sulfonic acid
naphthalene sulfonic acid dye intermediate
4-(4-amino-2-methylphenyl)-3-methylaniline
QYIMZXITLDTULQ-UHFFFAOYSA-N
CC1=C(C=CC(=C1)N)C2=C(C=C(C=C2)N)C