Naphthionic acid is an aminonaphthalenesulfonic acid used as a dye intermediate, particularly in the synthesis of naphthalene sulfonic acid-based dyes.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 84-86-6
5-aminonaphthalene-1-sulfonic acid
dye intermediate
4-((8-Hydroxy-6-sulfonaphthalen-2-yl)amino)benzoic acid
Naphthalene sulfonic acid dye intermediate
2-Naphthalenesulfonic acid, 4-hydroxy-6-(methylamino)-
Naphthalene sulfonic acid dye intermediate
2-Acetamido-5-hydroxy-7-naphthalenesulfonic acid
Naphthalene sulfonic acid dye intermediate
1-NAPHTHOL-4-SULFONIC ACID
dye intermediate
5,6-diaminonaphthalene-1-sulfonic acid
naphthalene sulfonic acid dye intermediate
C.I. Solvent Yellow 14
Dye for hydrocarbon solvents and oils
5-Amino-6-chloro-o-cresol
Hair dye ingredient
4-aminonaphthalene-1-sulfonic acid
NRZRRZAVMCAKEP-UHFFFAOYSA-N
C1=CC=C2C(=C1)C(=CC=C2S(=O)(=O)O)N