This compound is a Boc-protected derivative of proline, specifically this compound. It serves as a pharmaceutical intermediate for peptide synthesis, enabling the incorporation of a methoxy-substituted proline residue into peptide chains.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 83624-01-5
(3R)-3-amino-3-phenylpropanoic acid hydrochloride
pharmaceutical intermediate for peptide synthesis
N,N-Dimethyl3-Bromo-4-(4-methylphenyl)-4-oxobutanamide
Pharmaceutical intermediate for impurity synthesis
2-Benzyloxy-5-bromopyridine
Pharmaceutical intermediate
5-Methoxyindole-3-butyric acid
pharmaceutical intermediate
(2S,4R)-4-methoxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid
COHIMMPWCAHSFN-SFYZADRCSA-N
CC(C)(C)OC(=O)N1C[C@@H](C[C@H]1C(=O)O)OC