(3R)-3-Amino-3-phenylpropanoic acid hydrochloride is a chiral amino acid derivative used as a pharmaceutical intermediate. Its primary significance lies in serving as a building block for the synthesis of peptides and other active pharmaceutical ingredients.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 83649-48-3
2-N-Fmoc-aminomethyl piperidine
pharmaceutical intermediate for peptide synthesis
L-tert-Leucine methyl ester hydrochloride
pharmaceutical intermediate for peptide synthesis
(S)-Boc-3-Amino-3-phenylpropan-1-ol
pharmaceutical intermediate for peptide synthesis
(2S)-2-amino-3,3-dimethylbutanamide hydrochloride
pharmaceutical intermediate for peptide synthesis
N,N-Dimethyl3-Bromo-4-(4-methylphenyl)-4-oxobutanamide
Pharmaceutical intermediate for impurity synthesis
2-Benzyloxy-5-bromopyridine
Pharmaceutical intermediate
5-Methoxyindole-3-butyric acid
pharmaceutical intermediate
7-chloro-4-(piperazin-1-yl)quinoline
pharmaceutical intermediate
(3R)-3-amino-3-phenylpropanoic acid;hydrochloride
ABEBCTCOPRULFS-DDWIOCJRSA-N
C1=CC=C(C=C1)[C@@H](CC(=O)O)N.Cl