Dehydrocholic acid is a steroidal bile acid derivative used as a pharmaceutical raw material. Its structure features multiple ketone groups and a carboxylic acid moiety, contributing to its role in pharmaceutical manufacturing.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 81-23-2
Glycodehydrocholic acid
bile acid glycine conjugate
Cholic acid
active pharmaceutical ingredient
Warfarin
anticoagulant active pharmaceutical ingredient
Ethylbisiminomethylguaiacol manganese chloride
Active pharmaceutical ingredient
Pravastatin
active pharmaceutical ingredient
Sodium dehydrocholate
bile acid
Taurodehydrocholate
bile acid research reagent
(4R)-4-[(5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid
OHXPGWPVLFPUSM-KLRNGDHRSA-N
C[C@H](CCC(=O)O)[C@H]1CC[C@@H]2[C@@]1(C(=O)C[C@H]3[C@H]2C(=O)C[C@H]4[C@@]3(CCC(=O)C4)C)C