Taurodehydrocholate is a bile acid derivative used primarily as a research reagent in the study of bile acid chemistry and metabolism. Its structure includes a steroid backbone with multiple ketone groups and a taurine conjugate, making it a valuable tool for laboratory investigations.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 517-37-3
Glycodehydrocholic acid
bile acid glycine conjugate
2-METHYL-D3-1,4-NAPHTHOQUINONE
deuterated analytical reference standard
2-amino-1-(pyridin-3-yl)ethanone
research compound
5-Amino-2,4-dichloropyrimidine
Chemical research compound
Dimidium bromide
research compound
Dehydrocholic acid
pharmaceutical raw material
Sodium dehydrocholate
bile acid
2-[[(4R)-4-[(5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoyl]amino]ethanesulfonic acid
UBDJSBRKNHQFPD-PYGYYAGESA-N
C[C@H](CCC(=O)NCCS(=O)(=O)O)[C@H]1CC[C@@H]2[C@@]1(C(=O)C[C@H]3[C@H]2C(=O)C[C@H]4[C@@]3(CCC(=O)C4)C)C