Musk ketone is a synthetic musk compound used to emulate the scent of natural animal musks. It has a clean, smooth, and sweet odor and serves as a fixative in perfumes, cosmetics, and detergents, providing a long-lasting base note.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 81-14-1
4-Methyl-3-decen-5-ol
fragrance ingredient
(Z)-3,4,5,6,6-Pentamethylhept-3-en-2-one
Fragrance ingredient
Diisopentyl succinate
Fragrance and flavor ingredient
5-Methyl-2-hepten-4-one
flavor compound in food
1-(4-tert-butyl-2,6-dimethyl-3,5-dinitrophenyl)ethanone
WXCMHFPAUCOJIG-UHFFFAOYSA-N
CC1=C(C(=C(C(=C1[N+](=O)[O-])C(C)(C)C)[N+](=O)[O-])C)C(=O)C