2,4,6-Trifluorobenzoyl chloride is a fluorinated benzoyl chloride derivative used primarily as a pharmaceutical intermediate. Its structure features a benzene ring substituted with three fluorine atoms and a reactive acyl chloride group, making it a versatile building block in organic synthesis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 79538-29-7
4-(3,4-dichlorophenyl)-3,4-dihydro-1(2H)-naphthalenone
pharmaceutical intermediate for sertraline
4-methyl-4-(methyldisulfanyl)pentanoic acid
pharmaceutical intermediate
(S)-1-N-Boc-piperazine-2-carboxylic acid methyl ester
Pharmaceutical intermediate for API synthesis
4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride
Sertraline hydrochloride related compound
2,4,6-trifluorobenzoyl chloride
SIFIJQFBERMWMU-UHFFFAOYSA-N
C1=C(C=C(C(=C1F)C(=O)Cl)F)F
—