This compound is a chemical compound used as a pharmaceutical intermediate. Its primary significance is in the manufacturing process of sertraline, an active pharmaceutical ingredient.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 79560-19-3
4-methyl-4-(methyldisulfanyl)pentanoic acid
pharmaceutical intermediate
(S)-1-N-Boc-piperazine-2-carboxylic acid methyl ester
Pharmaceutical intermediate for API synthesis
4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride
Sertraline hydrochloride related compound
5-Bromo-2-methylbenzoic acid
Pharmaceutical intermediate
4-(3,4-dichlorophenyl)-3,4-dihydro-2H-naphthalen-1-one
JGMBHJNMQVKDMW-UHFFFAOYSA-N
C1CC(=O)C2=CC=CC=C2C1C3=CC(=C(C=C3)Cl)Cl