2,6-Dichloroaniline-3,4,5-d3 is a deuterium-labeled research compound, specifically This compound. Its primary significance lies in its use as an internal standard or tracer in analytical chemistry and metabolic studies, where the deuterium atoms allow for precise detection and quantification.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تبحث عن شراء 2,6-DICHLOROANILINE-3,4,5-D3؟
انشر طلب شراء مجانًا — دون الحاجة إلى حساب. يصل الطلب إلى مورّدي هذا المنتج، وتصلك الردود مباشرة عبر بريدك الإلكتروني.
Hydroxychloroquine-d4 Sulfate
Deuterium-labeled research compound
4-OHPropranolol-d7 HCl
Deuterium-labeled research compound
2-(1-adamantyl)propan-2-ol
Research compound
2-Amino-5-bromopyrimidine
research compound
5-Fluoro-2-methylbenzonitrile
Research compound
Dihydro-d2-2(3H)-furanone-3,3,4,5-d4
Deuterated reagent for analytical chemistry
2,6-DICHLOROANILINE
Chemical intermediate for dyes and agrochemicals
2,6-dichloro-3,4,5-trideuterioaniline
JDMFXJULNGEPOI-CBYSEHNBSA-N
[2H]C1=C(C(=C(C(=C1[2H])Cl)N)Cl)[2H]
هل تبحث عن شراء 2,6-DICHLOROANILINE-3,4,5-D3؟
انشر طلب شراء مجانًا — دون الحاجة إلى حساب. يصل الطلب إلى مورّدي هذا المنتج، وتصلك الردود مباشرة عبر بريدك الإلكتروني.