Hydroxychloroquine-d4 Sulfate is a deuterium-labeled research compound, structurally based on hydroxychloroquine where four hydrogen atoms are replaced with deuterium. It is primarily used as an internal standard or tracer in analytical and pharmaceutical research studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1216432-56-2
4-OHPropranolol-d7 HCl
Deuterium-labeled research compound
2,6-DICHLOROANILINE-3,4,5-D3
Deuterium-labeled research compound
Zolpidem Phenyl-4-carboxylic Acid Ethyl Ester-d6
research compound
N-Methyl-beta-alanine-d3
deuterated research compound
1-ethyl-6-fluoro-7-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid
research compound
(+/-)-linalool-d3
deuterated analytical standard
HYDROXYCHLOROQUINE SULFATE
active pharmaceutical ingredient
هيدروكسي كلوروكوين
active pharmaceutical ingredient
2-[[4-[(7-chloroquinolin-4-yl)amino]-1,1,2,2-tetradeuteriopentyl]-ethylamino]ethanol;sulfuric acid
JCBIVZZPXRZKTI-LINVOLBQSA-N
[2H]C([2H])(CC(C)NC1=C2C=CC(=CC2=NC=C1)Cl)C([2H])([2H])N(CC)CCO.OS(=O)(=O)O