Cyanomethyl N-methyl-N-phenylcarbamodithioate is a research reagent used primarily in chemical and pharmaceutical research settings. Its structure features an aromatic ring, an amine group, and a nitrile group, which contribute to its utility as a building block in synthetic chemistry.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 76926-16-4
Indole-2,4,5,6,7-d5-3-acetic acid
Deuterated biochemical research reagent
8-Bromo-cAMP sodium salt
research compound
2-Fluoro-4-methylbenzoic acid
research chemical intermediate
2-chloro-4-methylbenzoic acid
research compound
cyanomethyl N-methyl-N-phenylcarbamodithioate
FYACMHCOSCVNHO-UHFFFAOYSA-N
CN(C1=CC=CC=C1)C(=S)SCC#N
—