This compound is a pharmaceutical intermediate featuring a complex heterocyclic structure with trifluoromethyl and trifluorophenyl substituents. It is primarily used in the synthesis of active pharmaceutical ingredients.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 764667-65-4
(Z)-3-(Hydroxyimino)-1-(3-(trifluoromethyl)-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-7(8H)-yl)-4-(2,4,5-trifluorophenyl)butan-1-one
nitrosamine standard
(2S,3R)-3-acetamido-2-hydroxy-4-phenylbutanoic acid
peptide building block for synthesis
2-METHYL-1,3-CYCLOPENTANEDIONE
Synthetic building block for natural products
Methyl 3,3-diphenyloxirane-2-carboxylate
Intermediate for ambrisentan synthesis
Tert-butyl Piperazine-1-carboxylate Hydrochloride
Pharmaceutical intermediate for drug synthesis
1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butane-1,3-dione
QAEDTLFWHIEVPK-UHFFFAOYSA-N
C1CN2C(=NN=C2C(F)(F)F)CN1C(=O)CC(=O)CC3=CC(=C(C=C3F)F)F