Methyl 3,3-diphenyloxirane-2-carboxylate is a chemical compound used as a pharmaceutical intermediate, specifically in the synthesis of ambrisentan. It is characterized by an epoxide ring and two aromatic rings, with an ester functional group.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 76527-25-8
Tert-butyl Piperazine-1-carboxylate Hydrochloride
Pharmaceutical intermediate for drug synthesis
5-Bromo-2-fluoropyridine
Pharmaceutical intermediate
6,6-Dibromopenicillanic acid sulfone
Pharmaceutical intermediate for beta-lactam derivatives
3-(piperidin-4-yl)benzoic acid
Pharmaceutical intermediate
methyl 3,3-diphenyloxirane-2-carboxylate
ILXKNKDKHCSQTL-UHFFFAOYSA-N
COC(=O)C1C(O1)(C2=CC=CC=C2)C3=CC=CC=C3