This compound is a deuterium-labeled form of hexadecanoic acid, where four hydrogen atoms at positions 5 and 6 are replaced with deuterium. It is primarily used as an isotopically labeled fatty acid reference standard in analytical chemistry and research applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 75736-47-9
Hexacosanoic acid-d4
Stable isotope labeled reference standard
Lignoceric acid-d4-2
Deuterated fatty acid research standard
Meta-topolin
plant growth regulator research tool
Methan-d3-ol, p-toluenesulfonate
research reagent and reference standard
Tris[4,4'-bis(t-butyl)-2,2'-bipyridine]ruthenium(II) hexafluorophosphate
photoredox catalyst or research reagent
2,3,5-Tribromopyridine
research compound
Palmitic Acid-d4
Deuterated internal standard for fatty acid analysis
Palmitic Acid-d3
Deuterated fatty acid reference standard
5,5,6,6-tetradeuteriohexadecanoic acid
IPCSVZSSVZVIGE-AREBVXNXSA-N
[2H]C([2H])(CCCCCCCCCC)C([2H])([2H])CCCC(=O)O