Meta-topolin is a synthetic cytokinin compound used primarily as a research reagent in plant tissue culture studies. It is investigated for its role in regulating plant growth and development, particularly in mitigating hyperhydricity and improving regeneration efficiency.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 75737-38-1
Methan-d3-ol, p-toluenesulfonate
research reagent and reference standard
Tris[4,4'-bis(t-butyl)-2,2'-bipyridine]ruthenium(II) hexafluorophosphate
photoredox catalyst or research reagent
2,3,5-Tribromopyridine
research compound
2,3-Difluorobenzyl alcohol
research compound
6-Benzylaminopurine
plant growth regulator
3-[(7H-purin-6-ylamino)methyl]phenol
BUDWTFCZGZYQHZ-UHFFFAOYSA-N
C1=CC(=CC(=C1)O)CNC2=NC=NC3=C2NC=N3