This compound is a protected glutamic acid derivative featuring a tert-butyloxycarbonyl (Boc) protecting group and cyclohexyl ester moieties. It is primarily used as a pharmaceutical intermediate in peptide synthesis, particularly for the introduction of glutamic acid residues with orthogonal protection.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 73821-97-3
Boc-Asp(OcHx)-OH
protected amino acid for peptide synthesis
Acotiamide Impurity 36
pharmaceutical impurity reference standard
1,15-diethyl 2,2,14,14-tetramethyl-8-oxopentadecanedioate
pharmaceutical intermediate
5-(2-bromoacetyl)-2-hydroxybenzamide
Pharmaceutical intermediate
(4R)-5-(tert-butoxy)-4-{[(tert-butoxy)carbonyl]amino}-5-oxopentanoic acid
peptide synthesis intermediate
Boc-D-Glu(Ochex)-Oh
Protected amino acid for peptide synthesis
(2S)-5-cyclohexyloxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid
FDNMLANBNJDIRG-LBPRGKRZSA-N
CC(C)(C)OC(=O)N[C@@H](CCC(=O)OC1CCCCC1)C(=O)O