Boc-Asp(OcHx)-OH is a protected aspartic acid derivative used in peptide synthesis. The tert-butyloxycarbonyl (Boc) group protects the amino terminus, while the cyclohexyl ester protects the side-chain carboxyl group, enabling selective deprotection during solid-phase or solution-phase peptide assembly.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 73821-95-1
5-Cyclohexyl hydrogen N-[(1,1-dimethylethoxy)carbonyl]-L-glutamate
Pharmaceutical intermediate for peptide synthesis
Boc-D-Glu(Ochex)-Oh
Protected amino acid for peptide synthesis
Boc-D-alanine
protected amino acid for peptide synthesis
Boc-l-lys(ivdde)-oh
protected amino acid for peptide synthesis
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-5-phenylpentanoic acid
protected amino acid for peptide synthesis
Fmoc-D-Lys(Dde)-OH
protected amino acid for peptide synthesis
Acotiamide Impurity 36
pharmaceutical impurity reference standard
1,15-diethyl 2,2,14,14-tetramethyl-8-oxopentadecanedioate
pharmaceutical intermediate
(2S)-4-cyclohexyloxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid
NLPQIWFEEKQBBN-NSHDSACASA-N
CC(C)(C)OC(=O)N[C@@H](CC(=O)OC1CCCCC1)C(=O)O