This compound is an Fmoc-protected amino acid derivative, specifically this compound. It is used as a research reagent in peptide synthesis, where the Fmoc group serves as a temporary protecting group for the amino function.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 737007-45-3
Fmoc-D-Trp-OH
research compound for peptide synthesis
Fmoc-L-tryptophan
Protected amino acid for peptide synthesis
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-4-[(triphenylmethyl)carbamoyl]butanoic acid
Fmoc-protected amino acid derivative
N-alpha-(9-Fluorenylmethyloxycarbonyl)-L-glutamic-acid-alpha allyl ester
Fmoc-protected amino acid derivative
(R)-Nomega-(t-Butoxycarbonyl)-Nalpha-(9-fluorenylmethoxycarbonyl)-alpha-methylornithin
Fmoc-protected amino acid derivative
(S)-4-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-5-amino-5-oxopentanoic acid
Fmoc-protected amino acid derivative
5-(3-Aminophenyl)tetrazole
research compound
Rhodium(II) perfluorobutyrate dimer
Research reagent for organic synthesis
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propanoic acid
SEWQKWXKJVYKOO-QFIPXVFZSA-N
C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CNC5=C4C=CC=N5)C(=O)O