This compound is an Fmoc-protected amino acid derivative used as a building block in solid-phase peptide synthesis. It features a fluorenylmethyloxycarbonyl (Fmoc) protecting group on the amino terminus and an amide functional group, making it suitable for constructing peptide chains with specific side-chain modifications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 288149-55-3
N2-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-glutamine
Fmoc-protected amino acid for peptide synthesis
(4S)-5-(tert-butoxy)-4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-5-oxopentanoic acid
pharmaceutical intermediate
(4R)-5-(tert-butoxy)-4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-5-oxopentanoic acid
Fmoc-protected amino acid derivative
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-4-[(triphenylmethyl)carbamoyl]butanoic acid
Fmoc-protected amino acid derivative
N-alpha-(9-Fluorenylmethyloxycarbonyl)-L-glutamic-acid-alpha allyl ester
Fmoc-protected amino acid derivative
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propanoic acid
Fmoc-protected amino acid derivative
(R)-Nomega-(t-Butoxycarbonyl)-Nalpha-(9-fluorenylmethoxycarbonyl)-alpha-methylornithin
Fmoc-protected amino acid derivative
3-Isobutyl-1-methylxanthine
cyclic nucleotide phosphodiesterase inhibitor
(4S)-5-amino-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxopentanoic acid
MZRFDZFXTSDMFA-KRWDZBQOSA-N
C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCC(=O)O)C(=O)N