This compound is a deuterium-labeled research standard, specifically a trideuterated form of an androstane derivative featuring two hydroxyl groups and a steroidal backbone. It is primarily used as an isotopically labeled standard in analytical and laboratory research.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 73609-45-7
Octanoyl L-Carnitine-d3 Chloride
isotopically labeled research standard
N-tetracosane-d50
isotopically labeled research standard
1,2,3-trichloropropane (d5)
isotopically labeled research standard
DL-MEVALONOLACTONE-4,4,5,5-D4
isotopically labeled research standard
N-Tris(hydroxymethyl)methyl-2-aminoethanesulfonic acid
biological buffer substance
HEPES
zwitterionic biological buffer
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)propanoic acid
Fmoc-protected amino acid derivative
5-(3-Aminophenyl)tetrazole
research compound
(3S,8R,9S,10R,13S,14S,17S)-16,16,17-trideuterio-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-3,17-diol
QADHLRWLCPCEKT-KJEDCRHKSA-N
[2H][C@]1([C@]2(CC[C@H]3[C@H]([C@@H]2CC1([2H])[2H])CC=C4[C@@]3(CC[C@@H](C4)O)C)C)O
—