This compound is a pharmaceutical intermediate specifically used in the synthesis of dapagliflozin analogs. It is characterized by a complex molecular structure containing multiple hydroxyl groups, ether linkages, and an aromatic ring system.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 714269-57-5
4-(Aminomethyl)piperidine
Pharmaceutical intermediate for synthesis
Methyl 4-aminopyridine-2-carboxylate
Pharmaceutical intermediate
2-(4-Methylphenyl)benzoic acid
pharmaceutical intermediate
2-Bromopropionyl chloride
Pharmaceutical and agrochemical intermediate
Methyl 1-C-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-D-glucopyranoside
pharmaceutical intermediate
(2S,3R,4S,5S)-2-(4-chloro-3-(4-ethoxybenzyl)phenyl)-6,6-bis(hydroxymethyl)-2-methoxytetrahydro-2H-pyran-3,4,5-triol
Pharmaceutical intermediate
(2S,3R,4S,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol
GKTWLVVOULBRDU-BDHVOXNPSA-N
CCOC1=CC=C(C=C1)CC2=C(C=CC(=C2)[C@]3([C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)OC)Cl