This compound is a pharmaceutical intermediate, specifically a key building block used in the synthesis of the drug ertugliflozin. It is characterized as a complex polyhydroxylated molecule containing multiple alcohol and ether functional groups, featuring a tetrahydropyran ring system.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1528636-39-6
2-Propenal, 2-fluoro-3-(4-morpholinyl)-, (Z)-
Pharmaceutical intermediate
3-Chlorobenzyl cyanide
Pharmaceutical intermediate
1-(Hydroxymethyl)cyclopropaneacetonitrile
pharmaceutical intermediate
METHYL 1-(MERCAPTOMETHYL)CYCLOPROPANEACETATE
Pharmaceutical intermediate for synthesis
Methyl 1-C-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-D-glucopyranoside
pharmaceutical intermediate
(2S,3R,4S,5S,6R)-2-(4-Chloro-3-(4-ethoxybenzyl)phenyl)-6-(hydroxymethyl)-2-methoxytetrahydro-2H-pyran-3,4,5-triol
Pharmaceutical intermediate for dapagliflozin analogs
(2S,3R,4S,5S)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6,6-bis(hydroxymethyl)-2-methoxyoxane-3,4,5-triol
BLHXRCSRYWCZJZ-QXUYBEEESA-N
CCOC1=CC=C(C=C1)CC2=C(C=CC(=C2)[C@]3([C@@H]([C@H]([C@@H](C(O3)(CO)CO)O)O)O)OC)Cl