(2R)-2-(phenoxymethyl)oxirane is a research compound featuring an epoxide ring and a phenyl ether moiety. It is primarily used as a laboratory reagent for chemical synthesis and research applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 71031-02-2
2-ethynyl-5-hexylthiophene
Research compound
4,4,5,5-TETRAMETHYL-2-(3-(METHYLTHIO)PHENYL)-1,3,2-DIOXABOROLANE
Boronic ester protecting group
4-Morpholinepropanesulfonic acid, sodium salt
biological buffer reagent
MES sodium salt
Buffering agent for biochemical research
(2S)-2-(phenoxymethyl)oxirane
Pharmaceutical intermediate
Glycidyl phenyl ether
reactive diluent for epoxy resins
(2R)-2-(phenoxymethyl)oxirane
FQYUMYWMJTYZTK-VIFPVBQESA-N
C1[C@@H](O1)COC2=CC=CC=C2