1-(Benzyloxy)-4-bromobenzene is a brominated aromatic ether compound commonly used as a research reagent. Its structure features a bromine atom and a benzyloxy group attached to a benzene ring, making it useful in organic synthesis and materials research.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 6793-92-6
(-)-Dihydroaflatoxin D2
pharmaceutical reference standard
N-(2-Amino-4-chlorophenyl)anthranilic acid
research compound
Tetraethylammonium iodide
Quaternary ammonium research reagent
1H-Imidazole, monohydriodide
Research reagent
1-bromo-4-phenylmethoxybenzene
OUQSGILAXUXMGI-UHFFFAOYSA-N
C1=CC=C(C=C1)COC2=CC=C(C=C2)Br