N-(2-Amino-4-chlorophenyl)anthranilic acid is a research compound that is structurally related to anthranilic acid derivatives. It contains both amine and carboxylic acid functional groups, along with a chlorine substituent on the aromatic ring.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 67990-66-3
Tetraethylammonium iodide
Quaternary ammonium research reagent
1H-Imidazole, monohydriodide
Research reagent
4-(piperazin-1-yl)benzonitrile
research compound
(3,3-difluorocyclobutyl)methanol
research compound
2-(2-amino-4-chloroanilino)benzoic acid
HMVPMZFEYCGSTC-UHFFFAOYSA-N
C1=CC=C(C(=C1)C(=O)O)NC2=C(C=C(C=C2)Cl)N