3-Deazaadenosine is a research compound used for adenosine receptor studies. It is a structural analog of adenosine where the nitrogen atom at position 3 of the purine ring is replaced by carbon, and it features a ribose sugar moiety with multiple hydroxyl groups.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 6736-58-9
N6-Benzyl-5'-ethylcarboxamido Adenosine
Research compound for adenosine receptor studies
Methyl 2-methoxypyridine-3-carboxylate
Positron emission tomography radiotracer
1,3-Bis(diphenylphosphino)propane
Bidentate phosphine ligand for metal complexes
Decarboxylated S-Adenosylmethionine Sulfate Salt
research compound
Dichlorohexamethylbenzene ruthenium(II) dimer
research reagent for organometallic chemistry
4-Amino-6-chloro-1-b-D-ribofuranosylimidazo[4,5-c]pyridine
Pharmaceutical intermediate and research compound
(2R,3R,4S,5R)-2-(4-aminoimidazo[4,5-c]pyridin-1-yl)-5-(hydroxymethyl)oxolane-3,4-diol
DBZQFUNLCALWDY-PNHWDRBUSA-N
C1=CN=C(C2=C1N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N