1,3-Bis(diphenylphosphino)propane is a bidentate phosphine ligand used in organometallic chemistry. It coordinates to transition metals to form stable complexes, playing a key role in homogeneous catalysis and coordination chemistry research.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تبحث عن شراء 1,3-Bis(diphenylphosphino)propane؟
انشر طلب شراء مجانًا — دون الحاجة إلى حساب. يصل الطلب إلى مورّدي هذا المنتج، وتصلك الردود مباشرة عبر بريدك الإلكتروني.
Dichloro(1,1'-(1,3-propanediyl)bis(1,1-diphenylphosphine-kappaP))nickel
catalyst for organic synthesis
(1,3-Bis(diphenylphosphino)propane)palladium(II) chloride
catalyst for cross-coupling reactions
1,4-Bis(diphenylphosphino)butane
bidentate phosphine ligand
1,6-Bis(diphenylphosphino)hexane
bidentate phosphine ligand for catalysis
1,5-Bis(diphenylphosphino)pentane
organophosphorus ligand for coordination chemistry
(Octane-1,8-diyl)bis(diphenylphosphane)
Bidentate phosphine ligand
Decarboxylated S-Adenosylmethionine Sulfate Salt
research compound
Dichlorohexamethylbenzene ruthenium(II) dimer
research reagent for organometallic chemistry
3-diphenylphosphanylpropyl(diphenyl)phosphane
LVEYOSJUKRVCCF-UHFFFAOYSA-N
C1=CC=C(C=C1)P(CCCP(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4
هل تبحث عن شراء 1,3-Bis(diphenylphosphino)propane؟
انشر طلب شراء مجانًا — دون الحاجة إلى حساب. يصل الطلب إلى مورّدي هذا المنتج، وتصلك الردود مباشرة عبر بريدك الإلكتروني.