Bis-PEG1-NHS ester is a bifunctional crosslinking reagent containing two N-hydroxysuccinimide (NHS) ester groups connected by a short polyethylene glycol (PEG) spacer. It is primarily used in bioconjugation chemistry for the covalent coupling of amine-containing molecules.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 65869-64-9
Bis-PEG9-NHS ester
bifunctional PEG crosslinking reagent
Bis-PEG6-NHS ester
bifunctional crosslinking reagent
2,5,8,11,14,17,20,23,26,29,32,35-Dodecaoxaoctatriacontan-38-oic acid succinimidyl ester
PEG-based crosslinking reagent
4,7,10,13,16-Pentaoxanonadec-18-ynoic acid, 2,5-dioxo-1-pyrrolidinyl ester
PEG-linked alkyne NHS ester crosslinker
Tris(2,2,2-trifluoroethyl) borate
Organoboron research reagent
Methyl4,6-dichloronicotinate
Research compound
2-METHYLPYRIDINE-5-BORONIC ACID
research compound
Uracil
Nucleobase for RNA research
(2,5-dioxopyrrolidin-1-yl) 3-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]propanoate
OWCYSDGIJAVHFQ-UHFFFAOYSA-N
C1CC(=O)N(C1=O)OC(=O)CCOCCC(=O)ON2C(=O)CCC2=O