This compound is a polyethylene glycol (PEG)-based crosslinking reagent containing a succinimidyl ester group for conjugation with amine-functionalized molecules or surfaces. It is a highly flexible, non-aromatic heterocycle with numerous ether linkages, typically used in bioconjugation and surface modification applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 2207596-93-6
Bis-PEG9-NHS ester
bifunctional PEG crosslinking reagent
Bis-PEG6-NHS ester
bifunctional crosslinking reagent
Bis-PEG1-NHS ester
Bifunctional crosslinking reagent for bioconjugation
2-(2-bromophenyl)naphthalene
research chemical
Naphthalene, 2-(4-chlorophenyl)-
research compound
3-BROMO-7-CHLORO-FURO[2,3-C]PYRIDINE
research compound
1,2,3-benzothiadiazole-6-carboxylic acid
research compound
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate
ZMXRHHJWXLKMTL-UHFFFAOYSA-N
COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O