2-Fluorobenzoic Acid-d4 is a deuterated analytical reference standard, specifically the This compound isotopologue. This compound is primarily used in research and laboratory settings to enable precise quantification and tracing in analytical chemistry applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 646502-89-8
Dimetridazole D3
stable isotope labeled reference standard
2-Bromo-4,5-difluorobenzonitrile
Research compound
2-Bromo-4,5-difluorobenzoic acid
chemical synthesis intermediate
Triisopropylphosphine
Ligand in organometallic chemistry
2-FLUOROBENZOIC ACID
pharmaceutical intermediate
Sodium 2-fluorobenzoate
research compound
2,3,4,5-tetradeuterio-6-fluorobenzoic acid
NSTREUWFTAOOKS-RHQRLBAQSA-N
[2H]C1=C(C(=C(C(=C1[2H])C(=O)O)F)[2H])[2H]