3-Nitrophthalic anhydride is an organic compound that serves as a key intermediate in the synthesis of pharmaceuticals and fine chemicals. It is characterized by a nitro-substituted phthalic anhydride structure, making it valuable for constructing complex molecular architectures.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 641-70-3
Di-(2-ethylhexyl) terephthalate
Plasticizer for PVC and rubbers
1,2-difluoro-3-(trifluoromethyl)benzene
Industrial chemical intermediate
Sodium isooctadecanoate
surfactant and emulsifier ingredient
Morpholine, 4,4'-(oxydi-2,1-ethanediyl)bis-
Blowing agent for polyurethane foams
TETRACHLOROPHTHALIC ANHYDRIDE
flame retardant and chemical intermediate
3-Chlorophthalic anhydride
Pharmaceutical intermediate for synthesis
4-Chlorophthalic anhydride
Chemical intermediate for dyes and pigments
Trimellitic anhydride chloride
Pharmaceutical intermediate
4-nitro-2-benzofuran-1,3-dione
ROFZMKDROVBLNY-UHFFFAOYSA-N
C1=CC2=C(C(=C1)[N+](=O)[O-])C(=O)OC2=O