1,2-Difluoro-3-(trifluoromethyl)benzene is a fluorinated aromatic compound containing five fluorine atoms. It is primarily used as an industrial chemical intermediate in the synthesis of more complex organic molecules.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 64248-59-5
Sodium isooctadecanoate
surfactant and emulsifier ingredient
Morpholine, 4,4'-(oxydi-2,1-ethanediyl)bis-
Blowing agent for polyurethane foams
Trimethylolpropane tris(2-methyl-1-aziridinepropionate)
crosslinking agent for coatings
O-Phthalaldehyde
reagent for amino acid analysis
1,2-difluoro-3-(trifluoromethyl)benzene
CBOJZWDLNLMBLM-UHFFFAOYSA-N
C1=CC(=C(C(=C1)F)F)C(F)(F)F